On Target TRY1_HUMAN 0.62857145/CHEMBL2370424
For the given ligand Icatibant, we have found in our database that, being scored 0.62857145, the most similar ligand is CHEMBL2370424. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL2370424 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | NC(=N)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H]2Cc3ccccc3CN2)C=O |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00018008 01003200 00100100 14010e00 00000020 00000010 01000000 22003008 00200a80 000908c2 08300000 4003b000 06009812 00202001 80000400 02140000 00000000 02000020 00000008 00000201 00020100 38258620 00004003 83500018 00000800 c0000001 40004000 90000000 0c000110 0086000b a00c4000 00002600 |