On Target ACE_HUMAN 0.3286385/CHEMBL3414814
For the given ligand Nefazodone, we have found in our database that, being scored 0.3286385, the most similar ligand is CHEMBL3414814. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3414814 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | Cc1ccc(cc1)C2=Nc3ccccc3C(=O)N2CC(O)COc4cccc5[nH]c6ccccc6c45 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 04004002 00000008 a0100108 10010600 200c1060 02006120 06081800 00080008 06000102 d08208e0 0100800c 40018000 00809806 00e00000 012200c1 020c600c 00200020 0200a004 00e00000 00460000 c0100000 18008038 27800041 8c700010 00002002 c0000000 20000200 10840030 00004204 00460400 400c0a00 402000c0 |