On Target 5HT1B_HUMAN 0.35220125/CHEMBL347570
For the given ligand Balsalazide, we have found in our database that, being scored 0.35220125, the most similar ligand is CHEMBL347570. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL347570 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CN(CC1CCN(CCCc2c[nH]c3ccc(cc23)n4cnnc4)CC1)C(=O)c5ccc(NC(=O)C)cc5 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00004002 01801a08 40100100 c0810610 00041240 00000004 00042000 22001000 00600900 000808c0 08380004 50038000 88008802 00508800 00040440 000c000c 08048000 0200000c 08600400 00240201 40100100 18068608 21802000 8050001c 00042000 c0000000 08000080 90000080 00008100 0006000b a0040200 00202620 |