On Target TLR4_HUMAN 0.26666668/CHEMBL1223752
For the given ligand Balsalazide, we have found in our database that, being scored 0.26666668, the most similar ligand is CHEMBL1223752. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL1223752 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CC(C)CC(=O)Nc1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 04014002 01000008 20100008 00010700 20081000 02002000 02000000 00000008 00000000 000008c0 00280004 40009000 0480802a 00900000 11030041 00082008 00860000 00000000 0a402000 00020001 40100000 18000e00 31002000 00000010 00000000 00000000 00040000 10000080 00008200 00060001 00020000 10000200 |