On Target TLR4_HUMAN 0.30869564/CHEMBL382272
For the given ligand Icatibant, we have found in our database that, being scored 0.30869564, the most similar ligand is CHEMBL382272. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL382272 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CCCCCCCCCCCCCC(=O)N[C@H](COCC[C@@H](CCCCCCC)OC(=O)CCCCCCCCCCC)COP(=O)(O)OCCNC(=O)C(Cc1ccc(O)cc1)C(=O)O |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00010040 01004208 20100100 80010f00 000800c4 00080000 02004040 20002000 00000900 010808c0 08300000 c0019000 1c00800a 00820020 000a1008 000c1608 108e00a0 02800000 21c02018 00023203 00000120 1c000e10 330000c0 00500018 10001c01 80000000 02920000 10010001 00000200 0006001b 01020000 00018600 |