On Target OPRD_HUMAN 0.45901638/CHEMBL577394
For the given ligand Balsalazide, we have found in our database that, being scored 0.45901638, the most similar ligand is CHEMBL577394. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL577394 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCN(CC)C(=O)c1ccc(cc1)N(C2CCN(Cc3ccccc3)CC2)c4cccc(CO)c4 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00004002 01000c00 40100100 80010600 20000000 00004000 00000010 22001000 00002100 000009f0 00200004 50018000 00008802 00008000 00020440 00080008 00040000 02000000 08000002 80000201 61100000 18028620 20000000 0050001c 00040000 c0000000 02000000 90000080 00428100 00060011 e0040000 00000200 |