On Target OPRD_HUMAN 0.18518518/CHEMBL3967052
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.18518518, the most similar ligand is CHEMBL3967052. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3967052 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CC(=O)OCC(=O)N(CCN1[C@@H]2CC[C@H]1C[C@H](C2)c3cccc(O)c3)Cc4ccccc4.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00000008 43802208 20100302 84010600 00000080 40000010 02000000 22001008 00000800 000908c0 08300000 5001c000 00008802 00202000 00101408 000c0008 10060000 82000000 00002000 00020205 80000100 38008e10 12000001 0250001c 00000400 c0000000 00000000 90001001 08000302 0006000b 00060000 02002600 |