On Target CXCR4_HUMAN 0.31851852/CHEMBL2062277
For the given ligand Balsalazide, we have found in our database that, being scored 0.31851852, the most similar ligand is CHEMBL2062277. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL2062277 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCCN(CCC)CCCCN(C)Cc1ccc(CN(Cc2ncc[nH]2)Cc3nccn3C)cc1.OC(C(O)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00040002 00000000 00100900 10010e00 00200040 00100000 00000000 22003003 00200100 000018c0 00218008 4002d000 94009802 00000000 00020400 000c010c 00000000 02000002 01400000 00020201 80000001 18018a00 25000000 00400010 00100000 c0000000 00000000 90000000 00000106 00460800 60040000 00002200 |