On Target CNR2_HUMAN 0.24096386/CHEMBL3597331
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.24096386, the most similar ligand is CHEMBL3597331. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3597331 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | COC[C@@H](COC(=O)C)N(C)C(=O)CC\C=C\CCCCC(Cl)CCCCCC(Cl)Cl |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00020000 01004000 00100300 80010600 001000c0 00000000 00000000 20000402 10000000 01100080 00200000 40009000 04028002 00000000 00081408 00080008 10064000 00000000 01002000 02000201 00000020 10000f00 13008000 00000018 00200440 08000000 00c04000 90000001 04000200 80040009 24020000 00820a00 |