On Target CNR2_HUMAN 0.3961039/CHEMBL1762292
For the given ligand Alfentanil, we have found in our database that, being scored 0.3961039, the most similar ligand is CHEMBL1762292. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL1762292 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CC(C)(C)c1ccc(NC(=O)N2CCCN(CC2)C(=O)C3CCOCC3)cc1 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00040006 01003c00 00100100 44010f00 80180000 00000000 00000004 20002009 00000000 000a09e0 08280004 40009000 0400b002 0010a000 00000040 00081008 00040010 02400100 08400000 00000201 48000120 38090600 21022001 02400018 00110400 80000000 00000200 10000080 08008200 00060013 00100000 00006e00 |