On Target NTRK1_HUMAN 0.34892085/CHEMBL1258913
For the given ligand Icatibant, we have found in our database that, being scored 0.34892085, the most similar ligand is CHEMBL1258913. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL1258913 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | O=C(N[C@H](CN1CCCC1)c2ccccc2)c3cc4[nH]nc(NC(=O)c5ccc(cc5)N6CCOCC6)c4s3 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 000340c3 00803809 22103110 a5010600 000c0084 00800010 82800080 2201510c 00000180 108918c0 083c0b04 4000c080 000098b2 0110a022 0080344a 000c410c 11053000 0600010c 18600000 00220209 c0101080 7c228680 32816981 9340801c 02124400 c4200008 68360040 900004c4 0c408b08 00060013 80048000 00c16e60 |