On Target MTOR_HUMAN 0.4385246/CHEMBL4074753
For the given ligand Icatibant, we have found in our database that, being scored 0.4385246, the most similar ligand is CHEMBL4074753. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL4074753 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | Brc1ccc(cc1)C(N(C2CC2)C(=O)CCc3ccc(OCCCCNCCOCCOCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45)cc3)C(=O)NCc6ccccc6 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 04014000 4780f208 20100108 84110f40 00101080 02000000 02040004 22003048 04202880 020948c0 08300000 4007b000 0781981e 01042100 d1081409 000d2008 14001000 02002c00 00402068 00020301 c0000100 38258610 17000301 8b700018 00010c00 c0000000 00924200 90000021 0c000300 0006002b 200e6008 0b012e00 |