On Target OPRX_HUMAN 0.376/CHEMBL233493
For the given ligand Balsalazide, we have found in our database that, being scored 0.376, the most similar ligand is CHEMBL233493. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL233493 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | COc1ccccc1C2(O)CCN(CC2)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00000000 01000208 20100108 00010600 00001000 00004000 02000000 23001a00 00000900 000808c0 08300000 50018040 00000802 00000000 01000401 000c2008 00000000 02000000 00800000 00020201 00000100 18008020 01000080 00500410 00000001 e0000000 00000000 d0000000 00000380 0006800a 60044000 00000600 |