On Target OPRX_HUMAN 0.4258373/CHEMBL260555
For the given ligand Nefazodone, we have found in our database that, being scored 0.4258373, the most similar ligand is CHEMBL260555. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL260555 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | COc1ccc(C)c(OC(CCN2CCC(CC2)N3C(=O)N(Cc4ncnn4C)c5ccccc35)C(C)C)c1 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 04000007 01000408 60100108 00010701 810c1040 0200c084 42840000 20000401 04200100 900009e0 0d21802c 54018800 00809002 01c40000 013200c1 000c300c 00b08400 22008004 08e00000 00220a01 c0000000 38010030 61801881 02700090 00000001 c0004400 00020000 500a0000 00010304 00460210 c0080080 00002bc0 |