On Target OPRX_HUMAN 0.21367522/CHEMBL381287
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.21367522, the most similar ligand is CHEMBL381287. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL381287 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | O=C(NCCCN1CCC2(CC1)CCc3ccccc23)[C@H]4OC(=O)N[C@H]4Cc5ccccc5 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00010000 01405608 00100302 00010700 00000080 00008002 00000000 a0000005 00500a00 000809e0 08302000 5001d000 0c008002 00201300 00081000 021e0008 10060000 82080001 00402810 00000201 00000100 18280e90 13004040 81500018 00004000 80080003 10000000 10200001 04000202 0006001b 80000000 02402600 |