On Target FYN_HUMAN 0.34558824/CHEMBL407135
For the given ligand Alfentanil, we have found in our database that, being scored 0.34558824, the most similar ligand is CHEMBL407135. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL407135 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCC(C)CCCC(=O)N[C@@H](CCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@@H](NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O)[C@H](C)O |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00030000 01007400 00100000 04000400 00000080 00000000 00000000 20000008 00200000 000001a0 00200000 40033000 1600800a 00002001 80180000 00080008 10000000 00000000 00802000 00000201 00000000 300c0610 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040011 20024000 00802200 |