On Target CAH2_HUMAN 0.4903846/CHEMBL306510
For the given ligand Icatibant, we have found in our database that, being scored 0.4903846, the most similar ligand is CHEMBL306510. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL306510 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CC(C)[C@H](NC(=O)N(C)Cc1ccccn1)C(=O)N[C@H](C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)[C@@H](NC(=O)N(C)Cc3ccccn3)C(C)C)Cc4ccccc4 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00010002 01807000 00104102 14010e00 000c00a0 00100000 00000004 2200700f 00200880 000a08c0 09310004 4003b000 0400b802 00202000 001a0000 020c010c 10004010 02000000 00e02040 00000a01 c0000100 38358610 238000c1 83500018 00110001 80000000 00000040 90000000 0c001106 00060003 20064000 80006600 |