On Target CDK5_HUMAN 0.33464566/CHEMBL1983111
For the given ligand Icatibant, we have found in our database that, being scored 0.33464566, the most similar ligand is CHEMBL1983111. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL1983111 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CC(=O)NCC(=O)N1C2CCC1c3cc(Nc4ncc(c(NC5CCC5)n4)C(F)(F)F)ccc23 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 1001000a 01803801 00100182 dc090610 22000008 28006050 0000a800 22101889 00d00900 000908d0 08300004 4001b800 06008882 0020a810 00020cc0 000c0006 00042220 12004000 08402000 50a00201 cc1a0100 3c048600 20804841 02500058 00040004 c0200001 00004000 900110c0 0840810a 00c60803 60045000 000006c0 |