On Target ESR1_HUMAN 0.3909091/CHEMBL3645266
For the given ligand Balsalazide, we have found in our database that, being scored 0.3909091, the most similar ligand is CHEMBL3645266. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3645266 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | Oc1ccc(cc1)N(C(=O)c2ccc3ccccc3c2)c4ccc(O)cc4 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00004002 00000808 20000100 00010600 00000000 00000000 02000010 02001000 00002000 00000840 00280004 4000c000 00008822 00100000 00000040 00000008 00040000 02000000 08000002 00020000 40100000 08028608 20012000 00400004 00000000 80000000 02040000 80000080 00008100 00060001 80040000 00000200 |