On Target ESR1_HUMAN 0.265625/CHEMBL2165350
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.265625, the most similar ligand is CHEMBL2165350. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL2165350 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | Cl.CN(C)CCOc1ccc(cc1)c2ccc(OCC(=O)O)cc2 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 04002000 00000008 20000108 00010602 00001080 00000000 02040000 00000000 00000000 00000840 00240000 4000c000 00808012 00000000 01201001 00080008 00020000 82000000 04000000 00020000 00000000 08040a00 16000000 08400000 00000000 80000000 00020008 00800040 00004200 00060000 00000000 00020200 |