On Target ESR1_HUMAN 0.36585367/CHEMBL1475062
For the given ligand Alfentanil, we have found in our database that, being scored 0.36585367, the most similar ligand is CHEMBL1475062. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL1475062 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | O=C(CCCCCN1C(=S)Nc2ccccc2C1=O)N3CCC(CC3)Nc4ccccc4 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00054012 01001400 00100000 00000600 200c0000 00004060 02000000 20000800 06000100 c00c09e0 0120000c 50019000 0400900a 00e00000 000200c0 000c0004 20040000 01008100 08602020 00010201 e0100000 180c0638 21800041 00300018 00000000 80000000 20000000 10040080 0000c000 00470011 40080000 00012288 |