On Target 5HT2C_HUMAN 0.39716312/CHEMBL3597636
For the given ligand Balsalazide, we have found in our database that, being scored 0.39716312, the most similar ligand is CHEMBL3597636. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3597636 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | OC(CCNC(=O)c1cnc2ccccc2c1)CN3CCN(CC3)c4cccc5ccccc45 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 10004002 00809800 00104120 04010610 00041080 00000000 00004000 22001000 00200000 00000ac0 01200004 40028000 00008802 00402000 00100440 000c000c 10060000 02000004 08a00000 00000201 c0100000 38168e08 238000a1 8240001e 00040001 c0000000 08000000 90000080 08408100 00060001 a0040000 80000200 |