On Target 5HT2C_HUMAN 0.4516129/CHEMBL2397891
For the given ligand Icatibant, we have found in our database that, being scored 0.4516129, the most similar ligand is CHEMBL2397891. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL2397891 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | O=C1N2CCNC[C@H]2Cc3cccc(C4CC4)c13 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00000008 00003a00 00100100 14010600 00001021 00008000 00000000 2200100c 00000880 000908c0 08300000 40008000 00008882 01202000 00000400 020c0008 00000200 02000020 00000000 00000201 00c20100 38228640 01004021 8340001c 00000000 c0000001 00004000 90800000 0c000100 0086000b a0040000 00000600 |