On Target PTGES_HUMAN 0.38709676/CHEMBL3759709
For the given ligand Balsalazide, we have found in our database that, being scored 0.38709676, the most similar ligand is CHEMBL3759709. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3759709 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | Cc1ccc(CNC(=O)C(C)(C)C)cc1C(=O)Nc2ncc[nH]2 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00000002 00800800 00180100 10010600 00000041 00008000 10000000 02001000 00000100 20000c40 00308000 40009000 80008802 00200000 00000400 080c000c 00000000 02004000 00000800 00a00200 80020000 58028600 21000800 0040001c 00000000 c0000080 08000000 80000000 00000108 00461001 e0041000 00000300 |