On Target PTGES_HUMAN 0.33207548/CHEMBL3660830
For the given ligand Icatibant, we have found in our database that, being scored 0.33207548, the most similar ligand is CHEMBL3660830. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL3660830 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | Cn1c(Nc2c(Cl)ccc(CNC(=O)C(C)(C)C)c2Cl)nc3cc(C(=O)NCC(F)(F)F)c(cc13)C4CCc5ccc(Cl)cc5C4 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 1000800e 0580d800 00100102 50050600 00044044 0800e022 04000000 0a001005 00800900 800808d2 0930800c 40019800 0a0098e6 00600400 80000460 001e0044 00040208 12804004 08602000 10a00201 c0420900 5c168770 21c04801 0064001c 02446000 c0000601 04044040 90010180 0040811a 00c61843 e8048000 000207a0 |