On Target PTGES_HUMAN 0.14655173/CHEMBL3926051
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.14655173, the most similar ligand is CHEMBL3926051. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3926051 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | Cc1cccc2ccc(nc12)N3CC[C@H](C(=O)N[C@H]4CCOC4)C(C)(C)C3 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00024002 01005000 00104180 80010610 20041080 00002000 00000000 20100000 00200000 200008c0 00200004 50039000 04008802 00400000 000a1848 000c000c 10240000 02004000 08e00000 00a00201 40100000 1c108608 33800880 80700018 00040401 80000000 08800080 10000081 00008208 00060801 00041000 00802200 |