On Target MIF_HUMAN 0.24358974/CHEMBL3897449
For the given ligand Nefazodone, we have found in our database that, being scored 0.24358974, the most similar ligand is CHEMBL3897449. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3897449 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | NCCOc1ccc2nc(ccc2c1)c3cn(nn3)c4ccc(O)cc4.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 04000002 40010018 60104108 18810612 20041020 0000400c 02080000 00301800 00002100 10000860 80008004 40008840 00808886 00400000 01031041 820c200c 00020040 82003000 84640100 00463004 40020340 181c8a28 23801040 81404000 00202403 80200000 30040040 90002040 0500420c 10060400 50040200 17000200 |