On Target 5HT2B_HUMAN 0.4076923/CHEMBL473391
For the given ligand Balsalazide, we have found in our database that, being scored 0.4076923, the most similar ligand is CHEMBL473391. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL473391 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | O=C(N1CC(C1)c2nc3ccccc3[nH]2)c4ccc(cc4)c5ccccc5 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 0400200a 00001800 00100520 50010600 00040060 00004000 00000000 02001008 00000100 00000a40 01208004 40808000 80008802 00400000 01020441 020c0004 00020000 0a000000 04200000 10000200 40000000 18028620 31800000 0040001c 00001000 c0000000 00000000 80000040 00004104 00460801 e0040000 20000280 |