On Target HRH1_HUMAN 0.41007194/CHEMBL2171024
For the given ligand Balsalazide, we have found in our database that, being scored 0.41007194, the most similar ligand is CHEMBL2171024. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL2171024 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | OC(=O)c1cccc(c1)C(=O)N2CCC(CC2)N3CCC(CC3)Oc4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 04008000 01001c08 20100108 00010600 00001001 02004000 92800000 22001000 00000100 00000de0 40200000 50018800 02808806 00000002 01000403 08082008 00200000 02000400 00800000 40020201 00000000 180e8f20 01000080 0050001c 00002001 c0100000 08100000 90000000 00000300 00060011 e0040000 00022240 |