On Target NMDE1_HUMAN 0.07777778/CHEMBL284237
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.07777778, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |