On Target IKKB_HUMAN 0.39240506/CHEMBL514334
For the given ligand Balsalazide, we have found in our database that, being scored 0.39240506, the most similar ligand is CHEMBL514334. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL514334 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCN(C[C@H](NC(=O)c1ccc2[nH]c(nc2c1)c3ccncc3)C(=O)O)c4ccccc4 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 0000c00a 0000f800 00104120 14050600 200400e0 00004000 00000000 0200100c 00000100 10010a40 01308004 5001b000 8a008802 0040a000 00020440 020c000c 10040008 02002004 08a00010 00400200 40100000 38068e20 23800080 0240001e 00005001 c0000000 00000040 80000080 08408104 00460c01 e004c800 000002a0 |