On Target IKKB_HUMAN 0.30501932/CHEMBL1223063
For the given ligand Nefazodone, we have found in our database that, being scored 0.30501932, the most similar ligand is CHEMBL1223063. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL1223063 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | O=C(NC[C@@H]1CCCN1)c2ccc(cc2)c3cnc4ccc(NCCCn5ccnc5)nn34 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0000c003 01803809 e0101100 5c010610 21081060 0400001e 04c00000 22081a08 00200100 100109c0 0020800c 60018800 82009802 01942000 00070480 820c600c 08368000 0280200c 0c600000 50660605 e0100020 3c068620 21802803 0270c01c 00160401 c0080000 38100200 900008e0 0801411c 00462411 e00c0f00 10204600 |