On Target IKKB_HUMAN 0.33458647/CHEMBL372160
For the given ligand Icatibant, we have found in our database that, being scored 0.33458647, the most similar ligand is CHEMBL372160. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL372160 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CC(=O)NC(C)(C)CCc1ccc(s1)c2ccnc(Nc3ccc(cc3)C(=O)N4CCC(CC4)N5CCCC5)n2 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 0001a002 01001e10 80100103 80050600 01000004 10024010 020c2080 3e081008 00800d00 004809e1 00328204 f0018aa0 02008812 00308000 00022440 000c0004 02060000 12006008 0c410000 10a00205 40000900 5d0ea680 34802840 0850011c 02000100 c6000004 01000800 900103e4 0014811c 0046081b e8040800 00c126b3 |