On Target MK03_HUMAN 0.36805555/CHEMBL3798163
For the given ligand Balsalazide, we have found in our database that, being scored 0.36805555, the most similar ligand is CHEMBL3798163. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3798163 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | O=C(NCCc1ccccc1)c2ccc3[nH]nc(c4ccncc4)c3c2 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00002002 00009808 a0104100 40010600 01040000 00000002 02400000 02001004 00000180 00080840 08200004 60008000 80008812 00400000 00000400 000c200c 00220000 02000004 04600000 10220200 40000000 1c268608 30800800 8160401c 00100000 c0000000 10020000 80000060 04004104 00060003 a0040400 00004620 |