On Target PERM_HUMAN 0.3139535/CHEMBL2346670
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.3139535, the most similar ligand is CHEMBL2346670. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL2346670 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CCN(CCc1c[nH]c2ccc(F)cc12)S(=O)(=O)C |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000042 20000800 00100100 43310610 00041000 00000030 00012000 00000000 00400080 00490840 08202004 40008000 10000803 00401001 80000040 00040005 00000000 02000080 00200400 00104200 40000000 18208008 20800000 91400010 02042000 80000000 08000000 0000000d 04000000 00078002 00040200 00010660 |