Created at: Last updated at: Current status:
|
Name | Hydrochlorothiazide |
2D and 3D depictions |
|
SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O |
Model downloads | |
Fingerprints |
Name | Dolutegravir |
2D and 3D depictions |
|
SMILES | C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 |
Model downloads | |
Fingerprints |
Name | Metolazone |
2D and 3D depictions |
|
SMILES | Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C |
Model downloads | |
Fingerprints |
Name | Bendroflumethiazide |
2D and 3D depictions |
|
SMILES | NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O |
Model downloads | |
Fingerprints |
Name | Hydralazine |
2D and 3D depictions |
|
SMILES | NNc1nncc2ccccc12 |
Model downloads | |
Fingerprints |