On Target PERM_HUMAN 0.29655173/CHEMBL3633249
For the given ligand Dolutegravir, we have found in our database that, being scored 0.29655173, the most similar ligand is CHEMBL3633249. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3633249 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | COc1ccc(C2=CC(=O)NC(=S)N2CC(=O)NCCN)c(OC)c1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0005e003 00006c08 20100108 40050600 20181000 00004040 42040000 00082c00 06200100 800808e0 8821100c 6001a800 02009832 00d00000 01220881 040c220c 40064000 4300a104 04400020 01030800 80100000 38020620 b1802047 0250c10e 08000000 c0000000 30020020 00040040 08044304 10470011 40080c40 00010aa8 |