On Target ACES_HUMAN 0.38562092/CHEMBL575621
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.38562092, the most similar ligand is CHEMBL575621. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL575621 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c2ccc(cc2)C(C)(C)C |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000010 01801000 01100100 01b10600 00080008 00000000 00000000 20000000 00000000 004808c0 08202000 70018000 00000002 00000001 80600000 00000000 00002000 02000000 00402000 00006601 80000000 18040010 00000000 18400018 02000000 80000004 00000000 1000002c 00000400 20060002 00020000 00010670 |