On Target ACES_HUMAN 0.40174672/CHEMBL140106
For the given ligand Dolutegravir, we have found in our database that, being scored 0.40174672, the most similar ligand is CHEMBL140106. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL140106 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | O=C1N(CCC2CCN(Cc3ccccc3)CC2)C(=O)c4ncccc14 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 10000002 01809800 00104100 10010e10 00041020 00108000 00004080 22003001 00000000 000008c0 01290004 50018000 00008802 00300000 00020400 02040104 00020000 02000006 00300000 00000a01 c0020000 18078ea0 20802000 0050001c 00140000 c0200000 08004040 90000000 00400104 00060001 a0040000 80004200 |