On Target COMT_HUMAN 0.21/CHEMBL3425737
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.21, the most similar ligand is CHEMBL3425737. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3425737 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CC(C)C1=CC(=O)C(=CN1c2cccc(c2)c3ccccc3)O |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0000200a 00000208 60004100 10010610 00041028 04000004 14800000 00201000 02100000 800808c0 08008004 40818000 00008804 00400200 00020040 0204000c 00020000 02004004 04200000 00060000 40000000 18008010 30800000 81500410 02042400 c0080040 08120260 00050040 04404004 0206000a 00040000 60200400 |