On Target TRPV1_RAT 0.3601286/CHEMBL1395445
For the given ligand Dolutegravir, we have found in our database that, being scored 0.3601286, the most similar ligand is CHEMBL1395445. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL1395445 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCOC(=O)[C@H]1[C@H]2COc3ccc(Cl)cc3[C@@H]2N4C(=O)c5ccc(C)cc5NC(=O)[C@@]14C |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 1407c002 0d803818 6010012a 44010700 24381000 02112150 06000000 22081608 00900900 20190ad8 08380044 4001b840 8e80883e 01382000 91020641 0008300a 00a62000 23008503 18c02010 00820201 c0100170 38168f30 210020c1 0254041e 00043401 c0000000 00100210 90001080 08408302 00064003 a4044000 40c22e40 |