On Target FABP5_HUMAN 0.2733813/CHEMBL3950316
For the given ligand Dolutegravir, we have found in our database that, being scored 0.2733813, the most similar ligand is CHEMBL3950316. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3950316 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | Cc1cc(Cl)cc2c(c3ccccc3)c(C(=O)O)c(nc12)N4CCCCC4 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 1801e002 01800801 40104180 00010610 20041005 0001e040 14000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 a0020840 000c000e 00060000 02004004 0c200000 10a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |