On Target SC6A4_HUMAN 0.37931034/CHEMBL209324
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.37931034, the most similar ligand is CHEMBL209324. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL209324 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | COc1ccccc1N2CCN(CCCCNS(=O)(=O)c3ccc(C)cc3)CC2 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004012 02801008 21100128 05b10600 80081008 00000000 02000000 20000000 00200000 00400ac0 00202004 60028000 00000002 00002001 81600041 00004008 00042000 02000000 08400000 00026601 c0100000 38000000 20000021 1a40801a 02000000 80000004 20000000 100000ac 08008600 20060000 00000800 00010270 |