On Target HYES_HUMAN 0.48809522/CHEMBL2313199
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.48809522, the most similar ligand is CHEMBL2313199. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL2313199 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | Cc1ccc(c(C)c1)S(=O)(=O)N2CCC(CC2)C(=O)Nc3cccc(c3)C(F)(F)F |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00024012 03801000 41100100 01b10600 24080009 00002008 00000400 20000000 00200000 004008d0 00282004 70039004 04008002 01100001 80720040 00000008 00042080 02000000 08400000 00006611 c0100000 18000600 20002000 18400018 02042000 80000004 00000000 900000ac 00408400 20060201 00100000 00810270 |