On Target HYES_HUMAN 0.41152263/CHEMBL3104434
For the given ligand Dolutegravir, we have found in our database that, being scored 0.41152263, the most similar ligand is CHEMBL3104434. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3104434 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | FC(F)(F)c1ccc(NC(=O)N2CCOC3(CCN(CC3)C(=O)c4ccccn4)C2)cc1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 00000016 01005800 00104100 90210e00 000400a0 00100000 00000404 22003001 00200000 000008d0 00290004 50038000 00009802 01188000 000a1448 020c010c 30240000 02400002 08a00000 00000201 40000120 18178600 33822080 0050001c 10110401 c0000000 00800240 90000080 00008304 00060001 a01c0000 00004200 |