On Target TRPV3_HUMAN 0.30454546/CHEMBL3692262
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.30454546, the most similar ligand is CHEMBL3692262. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3692262 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CC(C)[C@H](CO)NCc1nc(ccc1F)c2cccc(c2)S(=O)(=O)N3CCCCC3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0000209a 01800000 01104100 17b10e00 008c01a1 00190022 00400000 02083041 00000000 104208c0 00212004 70018010 00000802 00001001 80620480 020c010d 12022200 02002022 04600000 00506601 c0000003 18018000 33800000 38400018 02100000 c0000004 00000c40 9000104d 00004504 20260402 21040800 20014270 |