On Target AMPN_HUMAN 0.24489796/CHEMBL1077591
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.24489796, the most similar ligand is CHEMBL1077591. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL1077591 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H]2Cc3c(CN(CC(=O)N[C@@H](Cc4ccccc4)C(=O)O)C2=O)[nH]c5ccccc35 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0001800a 0180fa08 20100100 55810e10 000412a0 00100000 03002000 2200300d 00400880 000908c0 08310004 4001b000 1e008882 0060a801 801204c0 020c010c 10000200 02000006 00600408 00020a01 c0020100 38278e08 23804043 93500018 00143880 c0000001 08124000 90000000 0c000104 0186000b 20044200 00006620 |