On Target AMPN_HUMAN 0.3212121/CHEMBL2332526
For the given ligand Metolazone, we have found in our database that, being scored 0.3212121, the most similar ligand is CHEMBL2332526. Check out the elaboration below.
| Metolazone (Given Ligand) | CHEMBL2332526 (Similar Ligand) |
|---|---|
| Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C | CC(C)C[C@H](NC(=O)Nc1ccccc1C)C(=O)NO |
|
|
|
|
|
|
| 1000c016 00802801 01004100 03b10e40 00020130 40110042 08000004 02003009 01800000 20084840 01282004 6000c800 02008846 00100001 802204c0 00000100 00044000 03400022 08010000 00806801 c0100100 08038700 20032000 0844001c 00102000 c0080000 00040010 800010c8 00008100 20060001 80040000 c0034221 | 00010006 01003010 40100100 00010e00 00000000 00000002 04000004 00002021 00000000 000208c0 00280004 4001b000 0400b004 00100000 00020040 00000010 00040000 02400030 08000000 000c0001 40000100 38050600 20022000 00400018 00110000 80000000 00000010 10001080 08008000 00060005 20084000 00404200 |