On Target AMPN_HUMAN 0.35915494/CHEMBL1077583
For the given ligand Dolutegravir, we have found in our database that, being scored 0.35915494, the most similar ligand is CHEMBL1077583. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL1077583 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](CN)C(C)C)C(=O)N[C@H]2Cc3c(CN(CC(=O)N[C@@H](Cc4ccccc4)C(=O)O)C2=O)[nH]c5ccccc35 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0001800a 0180fe08 20100100 55810e10 000412a0 00100000 03002000 2200300d 00400880 000909c0 08310004 4001b000 1e008882 0060a801 801204c0 020c010c 10000200 02000006 00600408 00020a01 c0020100 38278e08 23804043 93500018 00143880 c0000001 08124000 90000000 0c000104 0186001b 20044200 00006620 |