On Target ADRB2_HUMAN 0.48618785/CHEMBL347582
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.48618785, the most similar ligand is CHEMBL347582. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL347582 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | C[C@H](CNc1cccc(CC(=O)NS(=O)(=O)c2ccc(C)cc2)c1)NC[C@H](O)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0000c052 34801000 41100120 05b10600 20080088 00004000 04010000 00001000 00400180 00482a50 08202004 60009800 03008007 00003001 c0320040 00080008 12042000 02000000 08400000 00006600 c4100000 38200720 22000001 9b48001a 02042000 80000004 00000000 000080ac 0c408400 20060002 40002000 00030660 |